Shizukaol B
Shizukaol B is a disesquiterpenoid isolated from the roots of Chloranthus japonicus. Shizukaol B exhibits anti-inflammatory effects that suppresses expression of inducible nitric oxide synthase (iNOS) and cyclooxygenase-2 (COX-2), production of nitric oxide (NO), tumor necrosis factor-α (TNF-α), and interleukin-1β (IL-1β) in LPS-stimulated BV2 microglia.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5892 |
| Pricing | Inquire |
| Cas | 142279-40-1 |
| Molecular Weight | 732.779 |
| Molecular Formula | C40H44O13 |
| Canonical SMILES | CC1=CCOC(=O)CCC(=O)OCC2=C3CC4C(C5CC5C4(COC1=O)O)(C6C3(C7C8=C(C6)C9CC9C8(C(C(=O)C7=C(C)C(=O)OC)O)C)OC2=O)C |