2-C-(Hydroxymethyl)-2,3:5,6-di-O-isopropylidene-D-mannose
2-C-(Hydroxymethyl)-2,3:5,6-di-O-isopropylidene-D-mannose, an indispensable compound within the realm of biomedical sciences, finds extensive utility. Its criticality emerges from its involvement in synthesizing a diverse range of pharmaceuticals and therapeutic interventions catering to illnesses linked to carbohydrate metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70147-46-5 |
| Pricing | Inquire |
| Cas | 70147-46-5 |
| Molecular Weight | 290.31 |
| Molecular Formula | C13H22O7 |
| Canonical SMILES | O=CC1(OC(OC1C(O)C2OC(OC2)(C)C)(C)C)CO |