MC-Gly-Gly-Phe-Gly
| Supplier | Creative Peptides |
|---|---|
| Product # | R1896 |
| CAS # | 2413428-36-9 |
| Pricing | Inquire |
| Synonyms | DSN28369; DSN-28369; DSN 28369 |
| MolecularFormula | C25H31N5O8 |
| MolecularWeight | 529.22 |
| Sequence | MC-Gly-Gly-Phe-Gly |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| ShippingCondition | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |
| Explanation | MC-Gly-Gly-Phe-Gly is a cleavable ADC linker used for antibody-drug conjugates (ADCs). |
| ChemicalName | (6-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)hexanoyl)glycylglycyl-L-phenylalanylglycine |
| InChI | InChI=1S/C25H31N5O8/c31-19(9-5-2-6-12-30-22(34)10-11-23(30)35)26-14-20(32)27-15-21(33)29-18(25(38)28-16-24(36)37)13-17-7-3-1-4-8-17/h1,3-4,7-8,10-11,18H,2,5-6,9,12-16H2,(H,26,31)(H,27,32)(H,28,38)(H,29,33)(H,36,37)/t18-/m0/s1 |
| InChIKey | DWPLKZYCOGLRPC-SFHVURJKSA-N |
| CanonicalSMILES | O=C(CCCCCN1C(C=CC1=O)=O)NCC(NCC(N[C@@H](CC2=CC=CC=C2)C(NCC(O)=O)=O)=O)=O |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |