(S)-()-3-Methoxy-2-methyl-3-oxopropylzinc bromide solution
(S)-()-3-Methoxy-2-methyl-3-oxopropylzinc bromide solution is a reagent used in the synthesis of pharmaceutical drugs. It is particularly useful in the production of chiral compounds, which significantly contributes to targeted drug development for diseases like cancer and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 312693-18-8 |
| Pricing | Inquire |
| Cas | 312693-18-8 |
| Molecular Weight | 246.42 |
| Molecular Formula | CH3O2CCH(CH3)CH2ZnBr |
| Canonical SMILES | CC([CH2-])C(=O)OC.[Zn+]Br |