N-Acetyl-2'-O-[(tert-butyl)dimethylsilyl]-5'-O-DMT-6'-O-methylguanosine-3'-CE phosphoramidite
N-Acetyl-2'-O-[(tert-butyl)dimethylsilyl]-5'-O-DMT-6'-O-methylguanosine-3'-CE phosphoramidite is a vital tool in the biomedical industry that aids in the synthesis of modified RNA molecules. It is utilized to introduce specific modifications into RNA sequences, enabling researchers to explore the functional roles of such nucleotides in various cellular processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 153248-58-9 |
| Pricing | Inquire |
| Cas | 153248-58-9 |
| Molecular Weight | 956.15 |
| Molecular Formula | C49H66N7O9PSi |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)N2C=NC3=C2N=C(N=C3OC)NC(=O)C)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |