rac-Monepantel-[d5]
rac-Monepantel-[d5] is the labelled analogue of rac-Monepantel, which is an impurity of Monepantel. Monepantel is a new anthelmintic agent used in the treatment of parasitic nematodes via stun or kill without damaging the host entity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011535 |
| Pricing | Inquire |
| Molecular Weight | 478.43 |
| Molecular Formula | C20H8D5F6N3O2S |
| Canonical SMILES | CC(COC1=C(C=CC(=C1)C#N)C(F)(F)F)(C#N)NC(=O)C2=CC=C(C=C2)SC(F)(F)F |