5'-DMT-2'-O-MOE-5-Me-U-3'-PS-Phosphoramidite
5'-DMT-2'-O-MOE-5-Me-U-3'-PS-Phosphoramidite is a specialized nucleotide used in oligonucleotide synthesis. It comprises a dimethoxytrityl (DMT) protecting group at the 5' position, a 2'-O-methoxyethyl (MOE) modification on the ribose sugar, and a 5-methyluridine base. Additionally, it contains a phosphorothioate (PS) linkage at the 3' position. This phosphoramidite facilitates controlled addition during synthesis and enhances stability, making it suitable for various applications in molecular biology research, including gene synthesis, RNA interference, and nucleic acid probe development.
Supplier | BOC Sciences |
---|---|
Product # | BRP-00412 |
Pricing | Inquire |
Cas | 2360826-70-4 |
Molecular Weight | 916.05 |
Molecular Formula | C47H54N3O10PS2 |
Canonical SMILES | O=C(SCCSP(OC1C(OC(N2C=C(C(=O)NC2=O)C)C1OCCOC)COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)N6CCCC6)C=7C=CC=CC7 |