3,4-Dichlorophenylboronic Acid
Reactant involved in: Lithiation/borylation-protodeboronation of homoallyl carbamates; Suzuki coupling reactions. Precursor / reactant involved in synthesis of biologically active molecules including: Mycobacterium tuberculosis H37Rv chorismate mutase inhibitors; Pyrrole derivatives as PDE4B inhibitors; Nitrovinyl biphenyls as anticancer agents; Dual immunosuppressive and anti-inflammatory agents; Pyrazolopyrimidines as Cryptosporidium and Toxoplasma CDPK1 inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB010637 |
| Pricing | Inquire |
| Cas | 151169-75-4 |
| Molecular Weight | 190.82 |
| Molecular Formula | C6H5Cl2O2B |
| Canonical SMILES | B(C1=CC(=C(C=C1)Cl)Cl)(O)O |