5-Fluoro-UMP
5-Fluoro-UMP, a potent antineoplastic nucleotide analog, is utilized to combat several forms of cancer. It thwarts the synthesis of RNA and DNA by disturbing their natural cellular processes, ultimately culminating in apoptosis. Moreover, it's a key research tool to assess how changes in nucleotide metabolism can impact cellular maturation and proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 796-66-7 |
| Pricing | Inquire |
| Cas | 796-66-7 |
| Molecular Weight | 342.17 |
| Molecular Formula | C9H12FN2O9P |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)COP(=O)(O)O)O)O)F |