4-Hydroxyalternariol 9-methyl ether
4-Hydroxyalternariol 9-methyl ether is produced from fermentation of Alternaria sp. Samif01. It displays promising antioxidant effect. It shows antibacterial activity against several tested bacterial pathogens with minimum inhibitory concentration values in the range of 86.7-364.7 uM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 959417-17-5 |
| Pricing | Inquire |
| Cas | 959417-17-5 |
| Molecular Weight | 288.25 |
| Molecular Formula | C15H12O6 |
| Canonical SMILES | CC1=CC(=C(C2=C1C3=CC(=CC(=C3C(=O)O2)O)OC)O)O |