N4-Benzoyl-5'-O-benzoyl-2'-deoxycytidine
N4-Benzoyl-5'-O-benzoyl-2'-deoxycytidine, a compound of significant interest in the realm of biomedical research, exhibits promising potential as an antiviral agent. Its effectiveness against various viral infections, such as hepatitis B and influenza, has been observed. Intriguingly, studies indicate that this compound hampers viral replication and impedes viral entry into host cells, thus showcasing its robust antiviral properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 161664-22-8 |
| Pricing | Inquire |
| Cas | 161664-22-8 |
| Molecular Weight | 435.44 |
| Molecular Formula | C23H21N3O6 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(=O)C4=CC=CC=C4)O |