Clopidogrel Amide-[d4]
Clopidogrel Amide-[d4], is the labelled analogue of Clopidogrel Amide, which is a metabolite of Clopidogrel. Clopidogrel is an antiplatelet medication used to reduce the risk of heart disease and stroke in those at high risk.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002314 |
| Pricing | Inquire |
| Cas | 1219423-91-2 |
| Molecular Weight | 310.84 |
| Molecular Formula | C15H11D4ClN2OS |
| Canonical SMILES | C1CN(CC2=C1SC=C2)C(C3=CC=CC=C3Cl)C(=O)N |