Unguisin A
Unguisin A is a cyclic heptapeptide produced by the strain of the marine fungus E. unguis whose structure is comprised of amino acids and GABA. It binds to phosphate, pyrophosphate, and chloride but has no effect on chloride transport in a liposome-based assay.
| Supplier | BOC Sciences |
|---|---|
| Product # | 226956-06-5 |
| Pricing | Inquire |
| Cas | 226956-06-5 |
| Molecular Weight | 758.90 |
| Molecular Formula | C40H54N8O7 |
| Canonical SMILES | CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCCCC(=O)N1)CC2=CNC3=CC=CC=C32)C)C(C)C)CC4=CC=CC=C4)C(C)C |