N1-(1,1,1-Trifluoroethyl)pseudoUridine
N1-(1,1,1-Trifluoroethyl)pseudoUridine is a noteworthy biomedical substance, standing as a crucial tool against the proliferation of RNA viruses, facilitating the study in viral infections. As a modified nucleoside analog, it manifests exclusive attributes in restraining viral RNA replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1613529-80-8 |
| Pricing | Inquire |
| Cas | 1613529-80-8 |
| Molecular Weight | 326.23 |
| Molecular Formula | C11H13F3N2O6 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1CC(F)(F)F)C2C(C(C(O2)CO)O)O |