4,6-Dihydroxybenzofuran-3(2H)-one
4,6-Dihydroxybenzofuran-3(2H)-one (CAS# 3260-49-9) is an intermediate in synthesizing Diosmetin 3',7-Diglucuronide-d3 (D485042), a labelled Diosmetin 3',7-Diglucuronide (D485040), which is a metabolite of Diosmetin (D485000) which is a flavonoid often administered in the treatment of chronic venous insufficiency, hemorrhoids, and related affections.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB021341 |
| Pricing | Inquire |
| Cas | 3260-49-9 |
| Molecular Weight | 166.13 |
| Molecular Formula | C8H6O4 |
| Canonical SMILES | C1C(=O)C2=C(C=C(C=C2O1)O)O |