3-Isopropoxyphenylboronic acid
Reactant for synthesis of:• Heteroaryl benzylureas with glycogen synthase kinase 3 (GSK-3) inhibitory activity• Modulators of survival motor neuron (SMN) protein• Inhibitors of cholesteryl ester transfer protein (CETP)• Selective sphingosine-1-phosphate receptor subtype-1 agonists• Cytotoxic open lactone analogs of Lamellarin D
| Supplier | BOC Sciences |
|---|---|
| Product # | 216485-86-8 |
| Pricing | Inquire |
| Cas | 216485-86-8 |
| Molecular Weight | 180.01 |
| Molecular Formula | C9H13O3B |
| Canonical SMILES | B(C1=CC(=CC=C1)OC(C)C)(O)O |