2-Keto-4-methyl-[d3]-pentanoic acid sodium salt
2-Keto-4-methyl-[d3]-pentanoic acid sodium salt is an isotope analogue of 4-methyl-2-oxo-pentanoic acid, monosodium salt. 4-methyl-2-Oxovalerate is an immediate precursor and metabolite of L-leucine. It is a precursor leading to the synthesis of 2-methylpropyl glucosinolate, via L-leucine, in plants.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005682 |
| Pricing | Inquire |
| Cas | 93523-67-2 |
| Molecular Weight | 155.14 |
| Molecular Formula | C6H5D3NaO3 |
| Canonical SMILES | CC(C)CC(=O)C(=O)[O-].[Na+] |