Ixazomib Citrate
The citrate salt form of Ixazomib which is a proteasome inhibitor. It is undergoing a rollover Phase II trial against multiple myeloma, amyloidosis and lymphoma in sorts of countries. IC50 = 3.4 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04173 |
| Pricing | Inquire |
| Cas | 1239908-20-3 |
| Molecular Weight | 517.12 |
| Molecular Formula | C20H23BCl2N2O9 |
| Canonical SMILES | B1(OC(=O)C(O1)(CC(=O)O)CC(=O)O)C(CC(C)C)NC(=O)CNC(=O)C2=C(C=CC(=C2)Cl)Cl |