TFEB activator 1
TFEB activator 1 is an activator of transcription factor EB (TFEB) with promise for the prevention or treatment of Alzheimer's disease. TFEB activator 1 enhances autophagy without inhibiting the mTOR pathway and has the potential for neurodegenerative diseases treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39777-61-2 |
| Pricing | Inquire |
| Cas | 39777-61-2 |
| Molecular Weight | 294.34 |
| Molecular Formula | C19H18O3 |
| Canonical SMILES | COC1=CC=CC=C1C=CC(=O)C=CC2=CC=CC=C2OC |