Vasopressin-[d5]
Vasopressin-[d5] is a labelled analogue of Vasopressin. Vasopressin is a neurohypophysial hormone existing in most mammals. It has the function of regulating body's water retention via antidiuretic activity. Vasopressin is a peptidic V1a receptor agonist that can increase blood pressure by contracting the blood vessels.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-008178 |
| Pricing | Inquire |
| Cas | 1356383-11-3 |
| Molecular Weight | 1089.28 |
| Molecular Formula | C46H60D5N15O12S2 |
| Canonical SMILES | C1CC(N(C1)C(=O)C2CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2)CC(=O)N)CCC(=O)N)CC3=CC=CC=C3)CC4=CC=C(C=C4)O)N)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)N |