Muristerone A
Muristerone A, a phytoecdysteroid analog of ecdysone, acts as an inducer of ecdysone-inducible gene expression systems in mammalian cells and transgenic animals. It is an agonist of the ecdysteroid receptor (Kd = 1 nM), a nuclear receptor that heterodimerizes with a retinoid X receptor ortholog and regulates arthropod development. Muristerone A stimulates Bcl-XL mRNA transcription and inhibits TRAIL- and hFasL-induced apoptosis in RKO cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38778-30-2 |
| Pricing | Inquire |
| Cas | 38778-30-2 |
| Molecular Weight | 496.63 |
| Molecular Formula | C27H44O8 |
| Canonical SMILES | CC(C)CCC(C(C)(C1CCC2(C1(CC(C3C2=CC(=O)C4(C3(CC(C(C4)O)O)C)O)O)C)O)O)O |