Corynoxine B
Corynoxine B, a natural autophagy inducer, restores the deficient cytosolic translocation of HMGB1 and autophagy in cells overexpressing SNCA, which may be attributed to its ability to block SNCA-HMGB1 interaction.
Corynoxine B exhibited prolongation of the thiopental-induced hypnosis on oral administration in mice.
Corynoxine B exhibited prolongation of the thiopental-induced hypnosis on oral administration in mice.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17391-18-3 |
| Pricing | Inquire |
| Cas | 17391-18-3 |
| Molecular Weight | 384.47 |
| Molecular Formula | C22H28N2O4 |
| Canonical SMILES | CCC1CN2CCC3(C2CC1C(=COC)C(=O)OC)C4=CC=CC=C4NC3=O |