L-Thyroxine-[13C9,15N] Trifluoroacetic Acid
L-Thyroxine-[13C9,15N] Trifluoroacetic Acid is the labelled salt of L-Thyroxine, which can be used to treat thyroid hormone deficiency. It is one of the thyroid hormones involved in the maintenance of metabolic homeostasis.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011474 |
| Pricing | Inquire |
| Cas | 1435972-68-1 |
| Molecular Weight | 900.79 |
| Molecular Formula | C6[13C]9H11I4[15N]O4.C2HF3O2 |