Dynorphin B 1-13
Dynorphin B is a 13-residue opioid peptide, which is derived from the cleavage of prodynorphin and found widely distributed in the central nervous system. It acts as an opioid peptide and a κ-opioid receptor agonists. It has been implicated in antinociceptive functions. It has also been used to prime cardiogenesis in pluripotent embryonic stem cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010471 |
| Pricing | Inquire |
| Cas | 83335-41-5 |
| Molecular Weight | 1570.84 |
| Molecular Formula | C74H115N21O17 |
| Canonical SMILES | CC(C)CC(C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCCCN)C(=O)NC(C(C)C)C(=O)NC(C(C)C)C(=O)NC(C(C)O)C(=O)O)NC(=O)C(CC2=CC=CC=C2)NC(=O)CNC(=O)CNC(=O)C(CC3=CC=C(C=C3)O)N |