(S)-2-Amino-2-(3-bromophenyl)acetic acid
(S)-2-Amino-2-(3-bromophenyl)acetic acid is an amino acid derivative. This compound is significant in biochemical and pharmaceutical research for its potential role in drug development and molecular studies, leveraging its specific structural and chemical properties for targeted biological interactions and therapeutic applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016484 |
| Pricing | Inquire |
| Cas | 2088419-03-6 |
| Molecular Weight | 230.06 |
| Molecular Formula | C8H8BrNO2 |
| Canonical SMILES | C1=CC(=CC(=C1)Br)C(C(=O)O)N |