C18:1 Cyclic LPA (ammonium salt)
Cyclic phosphatidic acid is a naturally occurring analog of the growth factor-like phospholipid mediator, lysophosphatidic acid (LPA). Cyclic phosphatidic acid affects numerous cellular functions, including anti-mitogenic regulation of the cell cycle, induction of stress fiber formation, inhibition of tumor cell invasion and metastasis, and regulation of differentiation and survival of neuronal cells.
Supplier | BOC Sciences |
---|---|
Product # | 799268-69-2 |
Pricing | Inquire |
Cas | 799268-69-2 |
Molecular Weight | 421.55 |
Molecular Formula | C21H44NO5P |
Canonical SMILES | CCCCCCCCC=CCCCCCCCCOCC1COP(=O)(O1)[O-].[NH4+] |