PB-5266 B
PB-5266 B is a monobactam antibiotic isolated from the culture filtrate of Cytophaga johnsonae PB-5266. It exhibited weak antibacterial activity against a sensitive mutant of Escherichia coli to beta-lactam antibiotics.
Supplier | BOC Sciences |
---|---|
Product # | BBF-03331 |
Pricing | Inquire |
Cas | 108065-95-8 |
Molecular Weight | 453.38 |
Molecular Formula | C13H19N5O11S |
Canonical SMILES | C1C(C(=O)N1S(=O)(=O)O)NC(=O)C(=CC(=O)N)NC(=O)C(CO)NC(=O)C(CO)O |