N4-Benzoyl-5'-O-DMT-5-methylcytidine
N4-Benzoyl-5'-O-DMT-5-methylcytidine is an extensively researched biomedical compound, aiding in studying diverse ailments. Its efficacy lies in its capacity to precisely target and modulate RNA and DNA alterations, thereby impeding the growth and propagation of malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 160107-17-5 |
| Pricing | Inquire |
| Cas | 160107-17-5 |
| Molecular Weight | 663.72 |
| Molecular Formula | C38H37N3O8 |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O)O |