IMR-1
IMR-1 is a small-molecule inhibitor of Mastermind Recruitment-1. IMR-1 inhibits Notch target gene transcription via disrupting recruitment of Mastermind 1 to the Notch transcriptional activation complex on chromatin, thereby suppressing tumor growth.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-284841 |
| Pricing | 25 mg/unit USD $199 |
| Cas | 310456-65-6 |
| Molecular Weight | 353.407 |
| Molecular Formula | C15H15NO5S2 |
| Canonical SMILES | CCOC(=O)COC1=C(C=C(C=C1)C=C2C(=O)NC(=S)S2)OC |