5'-O-DMT-5-methoxyuridine
5'-O-DMT-5-methoxyuridine is a biomedical product extensively used in the pharmaceutical industry. It acts as an essential building block in the synthesis of antiviral drugs, particularly those targeting RNA viruses like hepatitis C and HIV. Its unique structure and pharmacological properties make it an indispensable component in the development of novel therapeutics against these diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-73-3 |
| Pricing | Inquire |
| Cas | 2095417-73-3 |
| Molecular Weight | 576.59 |
| Molecular Formula | C31H32N2O9 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=C(C(=O)NC5=O)OC)O)O |