Hedyotol D
Hedyotol D is a natural compound of immense potency, derived from Hedyotis diffusa. This prodigious concoction exhibits commendable efficacy in impeding the uncontrolled propagation of malignant cells and stimulating programmed cell death.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4209 |
| Pricing | Inquire |
| Cas | 97465-80-0 |
| Molecular Weight | 584.61 |
| Molecular Formula | C31H36O11 |
| Canonical SMILES | COC1=CC(=CC(=C1OC(CO)C(C2=CC(=C(C=C2)O)OC)O)OC)C3C4COC(C4CO3)C5=CC(=C(C=C5)O)OC |