I-BRD9
I-BRD9, as a selective cell active chemical probe for BRD9 (pIC50 = 7.3), it exhibits 200-fold selectivity for bromodomain containing protein 9 over the highly homologous BRD7 bromodomain, >70-fold selectivity for BRD9 over a panel of 34 other bromodomain
| Supplier | BOC Sciences |
|---|---|
| Product # | 1714146-59-4 |
| Pricing | Inquire |
| Cas | 1714146-59-4 |
| Molecular Weight | 497.55 |
| Molecular Formula | C22H22F3N3O3S2 |
| Canonical SMILES | CCN1C=C(C2=C(C1=O)C=C(S2)C(=NC3CCS(=O)(=O)CC3)N)C4=CC(=CC=C4)C(F)(F)F |