Virustomycin A
Virustomycin A is a 18-membered macrolide antibiotic originally isolated from Streptomyces sp. AM-2604. It is effective against infectious and plant pathogenic fungi. It is active against trichomonads and various RNA and DNA viruses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84777-85-5 |
| Pricing | Inquire |
| Cas | 84777-85-5 |
| Molecular Weight | 886.08 |
| Molecular Formula | C48H71NO14 |
| Canonical SMILES | CCC1C(C(CC(=CC=CC(C(OC(=O)C(=CC(=CC(C1O)C)C)OC)C(C)C(C(C)C2(CC(C(C(O2)C=CC)C)OC(=O)C=CC(=O)NC3=C(CCC3=O)O)O)O)OC)C)C)O |