eIF4E-IN-1
eIF4E-IN-1, a potent eIF4E inhibitor, inhibits immunosuppression components such as the immune checkpoint proteins PD-1, PD-L1, LAG3, TIM3, and/or IDO, in order to inhibit or release immunosuppression in certain diseases, such as cancer and infectious diseases. (Extracted from patent WO2021003194A1, compound Y)
| Supplier | BOC Sciences |
|---|---|
| Product # | 2573979-31-2 |
| Pricing | Inquire |
| Cas | 2573979-31-2 |
| Molecular Weight | 697.13 |
| Molecular Formula | C33H28ClF3N6O4S |
| Canonical SMILES | CC1=CC(=C2C(=N1)C(=CS2)C(=O)O)C3=C(C=CC(=C3)Cl)OCCN4C(=NC5=C(C4=O)C(=C(C(=C5)C(F)(F)F)N6CCN(CC6)C)C#N)C |