1,N6-Ethenoadenosine
N6-Ethenoadenosine, a purine nucleoside analog, is paramount for the examination of oxidative damage on cellular DNA. It has demonstrated a capability to initiate DNA damage and apoptosis in cancer cells, rendering it an integral component of investigating its effectiveness as an anticancer agent. Its potential usage within the realm of cancer treatment necessitates a thorough understanding and exploration of its capabilities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 39007-51-7 |
| Pricing | Inquire |
| Cas | 39007-51-7 |
| Molecular Weight | 291.26 |
| Molecular Formula | C12H13N5O4 |
| Canonical SMILES | C1=CN2C=NC3=C(C2=N1)N=CN3C4C(C(C(O4)CO)O)O |