Metronidazole-[d4] Hydrochloride
Metronidazole-[d4] Hydrochloride is the labelled salt of Metronidazole, which is a synthetic antibacterial and antiprotozoal agent of the nitroimidazole class. It is a limited spectrum antibiotic that has activity against anaerobic gram-positive and anaerobic gram-negative bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011611 |
| Pricing | Inquire |
| Cas | 1261397-74-3 |
| Molecular Weight | 211.64 |
| Molecular Formula | C6H6D4ClN3O3 |
| Canonical SMILES | CC1=NC=C(N1CCO)[N+](=O)[O-].Cl |