Boronic acid,B-[2-methyl-4-(1-methylethoxy)phenyl]-
Boronic Acid, B-[2-methyl-4-(1-methylethoxy)phenyl]- is an indispensable compound within the biomedical industry. Its exceptional versatility finds implementation in formulating treatments for diseases like cancer, diabetes, and inflammation. Its unique chemical attributes contribute immensely to the development of effective drugs, ensuring potent therapeutic interventions against these maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 871126-21-5 |
| Pricing | Inquire |
| Cas | 871126-21-5 |
| Molecular Weight | 194.04 |
| Molecular Formula | C10H15 B O3 |
| Canonical SMILES | B(C1=C(C=C(C=C1)OC(C)C)C)(O)O |