Folic Acid EP Impurity F
One of the impurities of Folic acid. Folic acid is a vitamin needed to synthesize DNA, conduct DNA repair and methylate DNA, and it also acts as a cofactor in biological reactions involving folate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1391194-56-1 |
| Pricing | Inquire |
| Cas | 1391194-56-1 |
| Molecular Weight | 211.61 |
| Molecular Formula | C7H6ClN5O |
| Canonical SMILES | C1=C(N=C2C(=N1)C(=O)NC(=N2)N)CCl |