ERK1/2 inhibitor 6
ERK1/2 inhibitor 6, a potent ERK1/2 inhibitor, has the potential to study or prevent cancer, inflammation, or other proliferative diseases. Mitogen-activated protein kinase (MAPK) plays an extremely important role in the signal transduction pathway, and extracellular signal regulated kinase (ERK) is a member of MAPK family. (Extracted from patent WO2021063335A1, compound 1)
| Supplier | BOC Sciences |
|---|---|
| Product # | 2634816-13-8 |
| Pricing | Inquire |
| Cas | 2634816-13-8 |
| Molecular Weight | 586.01 |
| Molecular Formula | C27H29ClFN7O5 |
| Canonical SMILES | CC(C(=O)NC(CO)C1=CC(=CC(=C1)F)OC)N2C=NN3C=C(C=C3C2=O)C4=NC(=NC=C4Cl)NC5CCOCC5 |