N4-Acetyl-5'-O-DMT-2'-O-propynylcytidine 3'-CE phosphoramidite
N4-Acetyl-5'-O-DMT-2'-O-propynylcytidine 3'-CE phosphoramidite is a key reagent widely used in the biomedical industry for nucleic acid synthesis. It enables the efficient introduction of N4-acetyl-5'-O-DMT-2'-O-propynylcytidine into oligonucleotides during solid-phase synthesis. This phosphoramidite plays a crucial role in drug development and research related to diseases such as cancer, viral infections, and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1498305-51-3 |
| Pricing | Inquire |
| Cas | 1498305-51-3 |
| Molecular Weight | 825.89 |
| Molecular Formula | C44H52N5O9P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OCC#C)N2C=CC(=NC2=O)NC(=O)C)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |