5-(5-Chloro-1-(2-fluorophenyl)-2-oxopentyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl Acetate Maleate
An impurity of Prasugrel. Prasugrel is a platelet inhibitor and an irreversible antagonist of P2Y12ADP receptors that prevents the formation of blood clots. It was appoved for the treatment of acute coronary syndrome (ACS), and some cardiovascular diseasess in combination with Aspirin.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0219-007244 |
| Pricing | Inquire |
| Cas | 1373350-61-8 |
| Molecular Weight | 525.972 |
| Molecular Formula | C24H25ClFNO7S |
| Canonical SMILES | CC(=O)OC1=CC2=C(S1)CCN(C2)C(C3=CC=CC=C3F)C(=O)CCCCl.C(=CC(=O)O)C(=O)O |