Potassium (3-methoxyphenyl)trifluoroborate
Potassium (3-methoxyphenyl)trifluoroborate is a highly prized compound extensively employed within the biomedical domain. It showcases its versatility as a reagent in pharmaceutical synthesis. By virtue of this attribute, it assumes a pivotal function in propelling the advancement of groundbreaking therapies addressing a myriad of maladies such as cancer, inflammation, and neurological malfunctions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 438553-44-7 |
| Pricing | Inquire |
| Cas | 438553-44-7 |
| Molecular Weight | 214.03 |
| Molecular Formula | C7H7BF3KO |
| Canonical SMILES | [B-](C1=CC(=CC=C1)OC)(F)(F)F.[K+] |