Pantoprazole Sulphone N-Oxide
An impurity of Pantoprazole which is a proton pump inhibitor used to treat erosive esophagitis (damage to the esophagus from stomach acid), and other conditions involving excess stomach acid such as Zollinger-Ellison syndrome.
| Supplier | BOC Sciences |
|---|---|
| Product # | 953787-55-8 |
| Pricing | Inquire |
| Cas | 953787-55-8 |
| Molecular Weight | 415.38 |
| Molecular Formula | C16H15F2N3O6S |
| Canonical SMILES | COC1=C(C(=[N+](C=C1)[O-])CS(=O)(=O)C2=NC3=C(N2)C=C(C=C3)OC(F)F)OC |