Siderochelin A
It is produced by the strain of Nocardia sp. SC 113, Act. sp. 69-209B-89. It has the effect against aerobic and anaerobic bacteria, and has anti-Gram-positive bacteria, Gram-negative bacteria and fungal effects but no anti-Candida albicans effect. The antibacterial activity of Siderochelin A is weaker than iron chelating agent Apoferrosamine. Fe2+, Fe3+, CO2+ and Zn2+ have antagonistic effects on Siderochelin A.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02910 |
| Pricing | Inquire |
| Cas | 77550-87-9 |
| Molecular Weight | 235.24 |
| Molecular Formula | C11H13N3O3 |
| Canonical SMILES | CC1(CC(N=C1C2=C(C=CC=N2)O)C(=O)N)O |