PPY A
PPY A is a potent inhibitor of T315l mutant and wild-type Abl kinases (IC50= 9 and 20 nM, respectively) that inhibits growth of cells transformed with either the Bcr-Abl T315l mutant or wild-type Bcr-Abl gene.
| Supplier | BOC Sciences |
|---|---|
| Product # | 875634-01-8 |
| Pricing | Inquire |
| Cas | 875634-01-8 |
| Molecular Weight | 372.42 |
| Molecular Formula | C22H20N4O2 |
| Canonical SMILES | CN(C)C(=O)C1=CN=CC(=C1)C2=CN=C3C(=C2)C(=CN3)C4=CC=CC=C4OC |