Vinblastine Impurity B
An impurity of Vinblastine. Vinblastine, isolated from Vinca rosea Linn., is an antitumor agent that is used for the treatment of kinds of cancers, including Hodgkin's lymphoma, non-small cell lung cancer, bladder cancer, brain cancer, melanoma, and testicular cancer. It binds tubulin and inhibits the assembly of microtubules.
| Supplier | BOC Sciences |
|---|---|
| Product # | 61936-68-3 |
| Pricing | Inquire |
| Cas | 61936-68-3 |
| Molecular Weight | 827 |
| Molecular Formula | C46H58N4O10 |
| Canonical SMILES | CCC1(CC2CC(C3=C(CC[N+](C2)(C1)[O-])C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O |