4-C-Hydroxymethyl-1,2-O-isopropylidine-3-O-(4-methoxybenzyl)-a-D-ribofuranose
4-C-Hydroxymethyl-1,2-O-isopropylidine-3-O-(4-methoxybenzyl)-α-D-ribofuranose, a compound of utmost importance in biomedicine, showcases its indispensability in the realm of pathology. The versatility of this compound is evident in its profound impact on combatting an assortment of diseases, ranging from malignant neoplasms to viral afflictions. Its remarkable pharmacological properties, marked by potent antineoplastic and antiviral efficacy, render it an indispensable cog in the wheel of drug discovery and therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 225233-47-6 |
| Pricing | Inquire |
| Cas | 225233-47-6 |
| Molecular Weight | 340.37 |
| Molecular Formula | C17H24O7 |
| Canonical SMILES | CC1(OC2C(C(OC2O1)(CO)CO)OCC3=CC=C(C=C3)OC)C |