2-Nitrophenyl b-D-cellobioside heptaacetate
1-Naphthyl β-D-cellobioside heptaacetate, a highly intricate and multifaceted compound, takes precedence in the realm of biomedicine. Its role centers around in-depth analysis and comprehension of the intricate intricacies involved in drug metabolism and enzymatic reactions. By acting as a potent chemical probe, it orchestrates the investigation of glycosidic enzymes and their inhibitors, thereby bolstering the progress towards revolutionary therapeutic interventions for an extensive array of ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70867-22-0 |
| Pricing | Inquire |
| Cas | 70867-22-0 |
| Molecular Weight | 757.65 |
| Molecular Formula | C32H39NO20 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2=CC=CC=C2[N+](=O)[O-])OC(=O)C)OC(=O)C)OC3C(C(C(C(O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |