2'-Deoxy-5'-O-FDMT-N2-isobutyryl-guanosine 3'-CE phosphoramidite
2'-Deoxy-5'-O-FDMT-N2-isobutyryl-guanosine 3'-CE phosphoramidite is a highly effective phosphoramidite building block for synthesizing oligonucleotides via solid-phase synthesis. Its diverse applications include the development of therapeutic drugs targeting a range of conditions, from cancer to genetic disorders and viral infections. Renowned for its efficacy and high yield, this compound is a go-to for researchers in the field of oligonucleotide synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1401422-21-6 |
| Pricing | Inquire |
| Cas | 1401422-21-6 |
| Molecular Weight | 1286.02 |
| Molecular Formula | C54H57F17N7O8P |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3CC(C(O3)COC(C4=CC=C(C=C4)CCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N |