(S)-Mesopram-[d7]
(S)-Mesopram-[d7] is the labelled S-isomer of Mesopram. Mesopram is an orally active, selective phosphodiesterase (PDE) 4 inhibitor. In vitro, mesopram selectively inhibits the activity of type 1 helper T (Th1) cells without affecting cytokine production or proliferation of type 2 helper T (Th2) cells. It decreases the synthesis of tumor necrosis factor-alpha (TNF-alpha) and interferon-gamma (IFN-gamma). Some studies conclude that the specific type-4 phosphodiesterase inhibitor mesopram ameliorates murine colitis both in a preventive and a therapeutic setting.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-000756 |
| Pricing | Inquire |
| Cas | 1795786-04-7 |
| Molecular Weight | 272.35 |
| Molecular Formula | C14H12D7NO4 |
| Canonical SMILES | CCCOC1=C(C=CC(=C1)C2(CNC(=O)O2)C)OC |